C18H14F6O — CID 91173371
3-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]but-2-en-1-ol (PubChem CID 91173371) has the molecular formula C18H14F6O and a molecular weight of 360.30 g/mol. Its IUPAC name is 3-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]but-2-en-1-ol.
| Compound Name | 3-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]but-2-en-1-ol |
|---|---|
| PubChem CID | 91173371 |
| Molecular Formula | C18H14F6O |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]but-2-en-1-ol |
| SMILES | CC(=CCO)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H14F6O/c1-11(6-7-25)12-2-4-13(5-3-12)14-8-15(17(19,20)21)10-16(9-14)18(22,23)24/h2-6,8-10,25H,7H2,1H3 |
| InChIKey | XJOPHXGSLFNKRR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |