C22H26O5 — CID 134927643
1-(3-butoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone (PubChem CID 134927643) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(3-butoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone.
| Compound Name | 1-(3-butoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone |
|---|---|
| PubChem CID | 134927643 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(3-butoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone |
| SMILES | CCCCOC1(O)OOC(c2ccccc2)(c2ccccc2)CC1C(C)=O |
| InChI | InChI=1S/C22H26O5/c1-3-4-15-25-22(24)20(17(2)23)16-21(26-27-22,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20,24H,3-4,15-16H2,1-2H3 |
| InChIKey | WTRKEIMFHYUVKX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|