C18H24O4 — CID 134927866
(3S,4aS,10bR)-3-tert-butyl-3,10,10b-trimethyl-4a,5-dihydrobenzo[h][1,2,4]benzotrioxin-6-one (PubChem CID 134927866) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (3S,4aS,10bR)-3-tert-butyl-3,10,10b-trimethyl-4a,5-dihydrobenzo[h][1,2,4]benzotrioxin-6-one.
| Compound Name | (3S,4aS,10bR)-3-tert-butyl-3,10,10b-trimethyl-4a,5-dihydrobenzo[h][1,2,4]benzotrioxin-6-one |
|---|---|
| PubChem CID | 134927866 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (3S,4aS,10bR)-3-tert-butyl-3,10,10b-trimethyl-4a,5-dihydrobenzo[h][1,2,4]benzotrioxin-6-one |
| SMILES | Cc1cccc2c1[C@@]1(C)OO[C@@](C)(C(C)(C)C)O[C@H]1CC2=O |
| InChI | InChI=1S/C18H24O4/c1-11-8-7-9-12-13(19)10-14-17(5,15(11)12)21-22-18(6,20-14)16(2,3)4/h7-9,14H,10H2,1-6H3/t14-,17-,18-/m0/s1 |
| InChIKey | BQXKKDGMUXKXTE-WBAXXEDZSA-N |
| XLogP | 3.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|