C13H18O4S — CID 134927961
(5R)-3-(2-hydroperoxypropan-2-yl)-5-(phenylsulfanylmethyl)dioxolane (PubChem CID 134927961) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (5R)-3-(2-hydroperoxypropan-2-yl)-5-(phenylsulfanylmethyl)dioxolane.
| Compound Name | (5R)-3-(2-hydroperoxypropan-2-yl)-5-(phenylsulfanylmethyl)dioxolane |
|---|---|
| PubChem CID | 134927961 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (5R)-3-(2-hydroperoxypropan-2-yl)-5-(phenylsulfanylmethyl)dioxolane |
| SMILES | CC(C)(OO)C1C[C@H](CSc2ccccc2)OO1 |
| InChI | InChI=1S/C13H18O4S/c1-13(2,17-14)12-8-10(15-16-12)9-18-11-6-4-3-5-7-11/h3-7,10,12,14H,8-9H2,1-2H3/t10-,12?/m1/s1 |
| InChIKey | NFLBWTXXRYROTN-RWANSRKNSA-N |
| XLogP | 3.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|