C13H18O3S — CID 135068110
2-[(3R,5R)-5-(phenylsulfanylmethyl)dioxolan-3-yl]propan-2-ol (PubChem CID 135068110) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-[(3R,5R)-5-(phenylsulfanylmethyl)dioxolan-3-yl]propan-2-ol.
| Compound Name | 2-[(3R,5R)-5-(phenylsulfanylmethyl)dioxolan-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 135068110 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-[(3R,5R)-5-(phenylsulfanylmethyl)dioxolan-3-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1C[C@H](CSc2ccccc2)OO1 |
| InChI | InChI=1S/C13H18O3S/c1-13(2,14)12-8-10(15-16-12)9-17-11-6-4-3-5-7-11/h3-7,10,12,14H,8-9H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | YYBSVYGEFVSKNP-ZYHUDNBSSA-N |
| XLogP | 2.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|