C34H50O2S — CID 134928440
1,3,3-trimethyl-2-[(1E,3E,5E)-3-methyl-7-[(2E,4E,6E)-5-methyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trienyl]sulfonylhepta-1,3,5-trienyl]cyclohexene (PubChem CID 134928440) has the molecular formula C34H50O2S and a molecular weight of 522.84 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E)-3-methyl-7-[(2E,4E,6E)-5-methyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trienyl]sulfonylhepta-1,3,5-trienyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E)-3-methyl-7-[(2E,4E,6E)-5-methyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trienyl]sulfonylhepta-1,3,5-trienyl]cyclohexene |
|---|---|
| PubChem CID | 134928440 |
| Molecular Formula | C34H50O2S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E)-3-methyl-7-[(2E,4E,6E)-5-methyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trienyl]sulfonylhepta-1,3,5-trienyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/CS(=O)(=O)C/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C34H50O2S/c1-27(19-21-31-29(3)17-13-23-33(31,5)6)15-9-11-25-37(35,36)26-12-10-16-28(2)20-22-32-30(4)18-14-24-34(32,7)8/h9-12,15-16,19-22H,13-14,17-18,23-26H2,1-8H3/b11-9+,12-10+,21-19+,22-20+,27-15+,28-16+ |
| InChIKey | XEDLQEZHVISFJZ-HYYBJHGMSA-N |
| XLogP | 9.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|