C13H16O3 — CID 134928854
(6R)-6-(2,5-dimethoxyphenyl)-3,6-dihydro-2H-pyran (PubChem CID 134928854) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (6R)-6-(2,5-dimethoxyphenyl)-3,6-dihydro-2H-pyran.
| Compound Name | (6R)-6-(2,5-dimethoxyphenyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134928854 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (6R)-6-(2,5-dimethoxyphenyl)-3,6-dihydro-2H-pyran |
| SMILES | COc1ccc(OC)c([C@H]2C=CCCO2)c1 |
| InChI | InChI=1S/C13H16O3/c1-14-10-6-7-12(15-2)11(9-10)13-5-3-4-8-16-13/h3,5-7,9,13H,4,8H2,1-2H3/t13-/m1/s1 |
| InChIKey | RSIHZWILWJAGNS-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|