C20H22O5 — CID 134929054
1-(3-ethoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone (PubChem CID 134929054) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 1-(3-ethoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone.
| Compound Name | 1-(3-ethoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone |
|---|---|
| PubChem CID | 134929054 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-(3-ethoxy-3-hydroxy-6,6-diphenyldioxan-4-yl)ethanone |
| SMILES | CCOC1(O)OOC(c2ccccc2)(c2ccccc2)CC1C(C)=O |
| InChI | InChI=1S/C20H22O5/c1-3-23-20(22)18(15(2)21)14-19(24-25-20,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18,22H,3,14H2,1-2H3 |
| InChIKey | OOVRMEVDICYVCP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|