C24H34OSSi — CID 134929579
tert-butyl-dimethyl-[(1R,2S)-2-(4-methylphenyl)-1-phenyl-2-prop-2-enylsulfanylethoxy]silane (PubChem CID 134929579) has the molecular formula C24H34OSSi and a molecular weight of 398.69 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2S)-2-(4-methylphenyl)-1-phenyl-2-prop-2-enylsulfanylethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R,2S)-2-(4-methylphenyl)-1-phenyl-2-prop-2-enylsulfanylethoxy]silane |
|---|---|
| PubChem CID | 134929579 |
| Molecular Formula | C24H34OSSi |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2S)-2-(4-methylphenyl)-1-phenyl-2-prop-2-enylsulfanylethoxy]silane |
| SMILES | C=CCS[C@@H](c1ccc(C)cc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H34OSSi/c1-8-18-26-23(21-16-14-19(2)15-17-21)22(20-12-10-9-11-13-20)25-27(6,7)24(3,4)5/h8-17,22-23H,1,18H2,2-7H3/t22-,23+/m1/s1 |
| InChIKey | XOIINIFIMJCKJK-PKTZIBPZSA-N |
| XLogP | 7.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|