C17H28O5 — CID 134931067
dimethyl 2-[(E,4R)-3-ethenyl-4-methoxy-5,5-dimethylhex-2-enyl]-2-methylpropanedioate (PubChem CID 134931067) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is dimethyl 2-[(E,4R)-3-ethenyl-4-methoxy-5,5-dimethylhex-2-enyl]-2-methylpropanedioate.
| Compound Name | dimethyl 2-[(E,4R)-3-ethenyl-4-methoxy-5,5-dimethylhex-2-enyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 134931067 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | dimethyl 2-[(E,4R)-3-ethenyl-4-methoxy-5,5-dimethylhex-2-enyl]-2-methylpropanedioate |
| SMILES | C=C/C(=C\CC(C)(C(=O)OC)C(=O)OC)[C@H](OC)C(C)(C)C |
| InChI | InChI=1S/C17H28O5/c1-9-12(13(20-6)16(2,3)4)10-11-17(5,14(18)21-7)15(19)22-8/h9-10,13H,1,11H2,2-8H3/b12-10+/t13-/m0/s1 |
| InChIKey | KLKAHVCORLYZIH-XSNHNAGMSA-N |
| XLogP | 2.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|