C13H18O5 — CID 142641476
1-ethoxycarbonyl-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 142641476) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-ethoxycarbonyl-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 1-ethoxycarbonyl-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 142641476 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-ethoxycarbonyl-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCOC(=O)C1(C(=O)O)C=CC=CC1OC(C)C |
| InChI | InChI=1S/C13H18O5/c1-4-17-12(16)13(11(14)15)8-6-5-7-10(13)18-9(2)3/h5-10H,4H2,1-3H3,(H,14,15) |
| InChIKey | JPRCEJXTBZJIIK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|