C16H18O4 — CID 57003412
2-methyl-1-(2-methylcyclohexa-2,5-dien-1-yl)oxycarbonylcyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 57003412) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclohexa-2,5-dien-1-yl)oxycarbonylcyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 2-methyl-1-(2-methylcyclohexa-2,5-dien-1-yl)oxycarbonylcyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 57003412 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-methyl-1-(2-methylcyclohexa-2,5-dien-1-yl)oxycarbonylcyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CC1=CCC=CC1OC(=O)C1(C(=O)O)C=CCC=C1C |
| InChI | InChI=1S/C16H18O4/c1-11-7-3-4-9-13(11)20-15(19)16(14(17)18)10-6-5-8-12(16)2/h4,6-10,13H,3,5H2,1-2H3,(H,17,18) |
| InChIKey | ZLZHFXSQLOLVNX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|