C22H32O12 — CID 134931649
[(2R,3R,6S)-6-methoxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl]-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 134931649) has the molecular formula C22H32O12 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(2R,3R,6S)-6-methoxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl]-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2R,3R,6S)-6-methoxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl]-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 134931649 |
| Molecular Formula | C22H32O12 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [(2R,3R,6S)-6-methoxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl]-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CO[C@@H]1C=C[C@@H](OC(C)=O)[C@@H](CC[C@@H]2O[C@@H](OC)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)O1 |
| InChI | InChI=1S/C22H32O12/c1-11(23)29-15-9-10-18(27-5)33-16(15)7-8-17-19(30-12(2)24)20(31-13(3)25)21(32-14(4)26)22(28-6)34-17/h9-10,15-22H,7-8H2,1-6H3/t15-,16-,17+,18+,19-,20+,21+,22-/m1/s1 |
| InChIKey | HZRVKSLVRMZCGD-IJKXCVAVSA-N |
| XLogP | 0.79 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|