C25H43IO2Si — CID 134932845
(1S,3S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-[(Z)-3-iodoprop-2-enyl]-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one (PubChem CID 134932845) has the molecular formula C25H43IO2Si and a molecular weight of 530.61 g/mol. Its IUPAC name is (1S,3S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-[(Z)-3-iodoprop-2-enyl]-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one.
| Compound Name | (1S,3S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-[(Z)-3-iodoprop-2-enyl]-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one |
|---|---|
| PubChem CID | 134932845 |
| Molecular Formula | C25H43IO2Si |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | (1S,3S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-[(Z)-3-iodoprop-2-enyl]-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one |
| SMILES | CC(C)[C@@H]1CC[C@@]23C[C@H](C/C=C\I)C(=O)[C@]2(C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]13C |
| InChI | InChI=1S/C25H43IO2Si/c1-17(2)19-12-13-25-15-18(11-10-14-26)21(27)24(25,7)20(16-23(19,25)6)28-29(8,9)22(3,4)5/h10,14,17-20H,11-13,15-16H2,1-9H3/b14-10-/t18-,19-,20+,23-,24-,25-/m0/s1 |
| InChIKey | YWXAAAIVCZVJFS-QMGKXCNRSA-N |
| XLogP | 7.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|