C22H36O2Si — CID 11210616
1-[(1S,3S,3aR,3bS,6aR,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-1,2,3,3a,3b,4,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]ethanone (PubChem CID 11210616) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is 1-[(1S,3S,3aR,3bS,6aR,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-1,2,3,3a,3b,4,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]ethanone.
| Compound Name | 1-[(1S,3S,3aR,3bS,6aR,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-1,2,3,3a,3b,4,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]ethanone |
|---|---|
| PubChem CID | 11210616 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-[(1S,3S,3aR,3bS,6aR,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-1,2,3,3a,3b,4,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]ethanone |
| SMILES | C=CC[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@H]3CC=C[C@H]3C[C@]12C(C)=O |
| InChI | InChI=1S/C22H36O2Si/c1-8-10-17-13-19(24-25(6,7)21(3,4)5)20-18-12-9-11-16(18)14-22(17,20)15(2)23/h8-9,11,16-20H,1,10,12-14H2,2-7H3/t16-,17-,18-,19-,20-,22-/m0/s1 |
| InChIKey | MBSOPVXZACMCKA-HVYFOGIKSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|