C14H15ClN2OS — CID 134933657
(2S,3S)-2-butylsulfanyl-3-chloro-4-oxo-1-phenylazetidine-3-carbonitrile (PubChem CID 134933657) has the molecular formula C14H15ClN2OS and a molecular weight of 294.81 g/mol. Its IUPAC name is (2S,3S)-2-butylsulfanyl-3-chloro-4-oxo-1-phenylazetidine-3-carbonitrile.
| Compound Name | (2S,3S)-2-butylsulfanyl-3-chloro-4-oxo-1-phenylazetidine-3-carbonitrile |
|---|---|
| PubChem CID | 134933657 |
| Molecular Formula | C14H15ClN2OS |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (2S,3S)-2-butylsulfanyl-3-chloro-4-oxo-1-phenylazetidine-3-carbonitrile |
| SMILES | CCCCS[C@@H]1N(c2ccccc2)C(=O)[C@@]1(Cl)C#N |
| InChI | InChI=1S/C14H15ClN2OS/c1-2-3-9-19-13-14(15,10-16)12(18)17(13)11-7-5-4-6-8-11/h4-8,13H,2-3,9H2,1H3/t13-,14-/m0/s1 |
| InChIKey | RINRUAISZSDWBV-KBPBESRZSA-N |
| XLogP | 3.39 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|