C15H23N3OS — CID 73263515
3-hexylsulfanyl-6-phenyl-1,2,4-triazinan-5-one (PubChem CID 73263515) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-hexylsulfanyl-6-phenyl-1,2,4-triazinan-5-one.
| Compound Name | 3-hexylsulfanyl-6-phenyl-1,2,4-triazinan-5-one |
|---|---|
| PubChem CID | 73263515 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-hexylsulfanyl-6-phenyl-1,2,4-triazinan-5-one |
| SMILES | CCCCCCSC1NNC(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C15H23N3OS/c1-2-3-4-8-11-20-15-16-14(19)13(17-18-15)12-9-6-5-7-10-12/h5-7,9-10,13,15,17-18H,2-4,8,11H2,1H3,(H,16,19) |
| InChIKey | VHVGQFODKAAFDN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|