C18H17Cl2NO4S — CID 134933796
ethyl (Z)-3-(2,4-dichlorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate (PubChem CID 134933796) has the molecular formula C18H17Cl2NO4S and a molecular weight of 414.31 g/mol. Its IUPAC name is ethyl (Z)-3-(2,4-dichlorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(2,4-dichlorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 134933796 |
| Molecular Formula | C18H17Cl2NO4S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | ethyl (Z)-3-(2,4-dichlorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\NS(=O)(=O)c1ccc(C)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2NO4S/c1-3-25-18(22)11-17(15-9-6-13(19)10-16(15)20)21-26(23,24)14-7-4-12(2)5-8-14/h4-11,21H,3H2,1-2H3/b17-11- |
| InChIKey | POCPZKCTHJWRAS-BOPFTXTBSA-N |
| XLogP | 4.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|