C15H30OSi — CID 134934878
1-[3-ethenyl-2-(trimethylsilylmethyl)cyclopentyl]-2-methylpropan-1-ol (PubChem CID 134934878) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is 1-[3-ethenyl-2-(trimethylsilylmethyl)cyclopentyl]-2-methylpropan-1-ol.
| Compound Name | 1-[3-ethenyl-2-(trimethylsilylmethyl)cyclopentyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 134934878 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 1-[3-ethenyl-2-(trimethylsilylmethyl)cyclopentyl]-2-methylpropan-1-ol |
| SMILES | C=CC1CCC(C(O)C(C)C)C1C[Si](C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-7-12-8-9-13(15(16)11(2)3)14(12)10-17(4,5)6/h7,11-16H,1,8-10H2,2-6H3 |
| InChIKey | ZRDKEWIGZJHBLU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|