C17H30O6S2 — CID 134936373
1-[(3aR,5R,6S,6aR)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(1,3-dithian-2-yl)ethanol (PubChem CID 134936373) has the molecular formula C17H30O6S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(1,3-dithian-2-yl)ethanol.
| Compound Name | 1-[(3aR,5R,6S,6aR)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(1,3-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 134936373 |
| Molecular Formula | C17H30O6S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(1,3-dithian-2-yl)ethanol |
| SMILES | COC(C)(C)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(O)CC1SCCCS1 |
| InChI | InChI=1S/C17H30O6S2/c1-16(2,19-5)21-13-12(10(18)9-11-24-7-6-8-25-11)20-15-14(13)22-17(3,4)23-15/h10-15,18H,6-9H2,1-5H3/t10?,12-,13+,14-,15-/m1/s1 |
| InChIKey | FBKZYHBJUYKYTP-NGXDWLFCSA-N |
| XLogP | 2.58 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|