C17H30O5S2 — CID 134878389
[(5S)-5-[(1R)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanol (PubChem CID 134878389) has the molecular formula C17H30O5S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is [(5S)-5-[(1R)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanol.
| Compound Name | [(5S)-5-[(1R)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 134878389 |
| Molecular Formula | C17H30O5S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(5S)-5-[(1R)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanol |
| SMILES | C[C@H](C1COC(C)(C)O1)[C@@H]1OC(C)(C)OC1C(O)C1SCCCS1 |
| InChI | InChI=1S/C17H30O5S2/c1-10(11-9-19-16(2,3)20-11)13-14(22-17(4,5)21-13)12(18)15-23-7-6-8-24-15/h10-15,18H,6-9H2,1-5H3/t10-,11?,12?,13+,14?/m1/s1 |
| InChIKey | GPUBTMHPASSBAH-DQDKNNDFSA-N |
| XLogP | 2.85 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |