C15H28O3S2 — CID 134937587
(2S,3R,4R)-3-(1,3-dithian-2-yl)-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-ol (PubChem CID 134937587) has the molecular formula C15H28O3S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (2S,3R,4R)-3-(1,3-dithian-2-yl)-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-ol.
| Compound Name | (2S,3R,4R)-3-(1,3-dithian-2-yl)-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-ol |
|---|---|
| PubChem CID | 134937587 |
| Molecular Formula | C15H28O3S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2S,3R,4R)-3-(1,3-dithian-2-yl)-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-ol |
| SMILES | C[C@@H]([C@@H]1OC(C)(C)O[C@H]1C)[C@@H](C1SCCCS1)[C@H](C)O |
| InChI | InChI=1S/C15H28O3S2/c1-9(13-11(3)17-15(4,5)18-13)12(10(2)16)14-19-7-6-8-20-14/h9-14,16H,6-8H2,1-5H3/t9-,10+,11+,12-,13+/m1/s1 |
| InChIKey | ANJUJNXPHBLYBN-SJHCENCUSA-N |
| XLogP | 3.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |