C18H18O3 — CID 134936602
(1S,9R)-9-ethyl-8-methyl-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 134936602) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1S,9R)-9-ethyl-8-methyl-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9R)-9-ethyl-8-methyl-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 134936602 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (1S,9R)-9-ethyl-8-methyl-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | CC[C@]12OO[C@](c3ccccc3)(O1)c1ccccc1C2C |
| InChI | InChI=1S/C18H18O3/c1-3-17-13(2)15-11-7-8-12-16(15)18(19-17,21-20-17)14-9-5-4-6-10-14/h4-13H,3H2,1-2H3/t13?,17-,18+/m1/s1 |
| InChIKey | XWOSFZRRDHGMFX-YMSDKTMASA-N |
| XLogP | 4.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|