C8H9Br2NO2S — CID 134937081
(1R,2S)-1,2-dibromo-2-phenylethanesulfonamide (PubChem CID 134937081) has the molecular formula C8H9Br2NO2S and a molecular weight of 343.04 g/mol. Its IUPAC name is (1R,2S)-1,2-dibromo-2-phenylethanesulfonamide.
| Compound Name | (1R,2S)-1,2-dibromo-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 134937081 |
| Molecular Formula | C8H9Br2NO2S |
| Molecular Weight | 343.04 g/mol |
| Exact Mass | 340.87 |
| IUPAC Name | (1R,2S)-1,2-dibromo-2-phenylethanesulfonamide |
| SMILES | NS(=O)(=O)[C@H](Br)[C@@H](Br)c1ccccc1 |
| InChI | InChI=1S/C8H9Br2NO2S/c9-7(8(10)14(11,12)13)6-4-2-1-3-5-6/h1-5,7-8H,(H2,11,12,13)/t7-,8-/m0/s1 |
| InChIKey | XLGXRTHORKXRRA-YUMQZZPRSA-N |
| XLogP | 2.13 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.04 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|