C14H17NO4 — CID 134937574
ethyl (1S,4R,5R)-3-benzyl-1-methyl-2,6-dioxa-3-azabicyclo[3.1.0]hexane-4-carboxylate (PubChem CID 134937574) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl (1S,4R,5R)-3-benzyl-1-methyl-2,6-dioxa-3-azabicyclo[3.1.0]hexane-4-carboxylate.
| Compound Name | ethyl (1S,4R,5R)-3-benzyl-1-methyl-2,6-dioxa-3-azabicyclo[3.1.0]hexane-4-carboxylate |
|---|---|
| PubChem CID | 134937574 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl (1S,4R,5R)-3-benzyl-1-methyl-2,6-dioxa-3-azabicyclo[3.1.0]hexane-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2O[C@@]2(C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-3-17-13(16)11-12-14(2,18-12)19-15(11)9-10-7-5-4-6-8-10/h4-8,11-12H,3,9H2,1-2H3/t11-,12-,14+/m1/s1 |
| InChIKey | ODGZHZFCPUWLIN-BZPMIXESSA-N |
| XLogP | 1.48 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|