C25H32F4O4S — CID 134938946
1,1,1-trifluoro-7-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]heptane-3-sulfonyl fluoride (PubChem CID 134938946) has the molecular formula C25H32F4O4S and a molecular weight of 504.59 g/mol. Its IUPAC name is 1,1,1-trifluoro-7-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]heptane-3-sulfonyl fluoride.
| Compound Name | 1,1,1-trifluoro-7-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]heptane-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 134938946 |
| Molecular Formula | C25H32F4O4S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 1,1,1-trifluoro-7-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]heptane-3-sulfonyl fluoride |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCCC(CC(F)(F)F)S(=O)(=O)F)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C25H32F4O4S/c1-24-12-11-20-19-8-6-17(14-16(19)5-7-21(20)22(24)9-10-23(24)30)33-13-3-2-4-18(34(29,31)32)15-25(26,27)28/h6,8,14,18,20-22H,2-5,7,9-13,15H2,1H3/t18?,20-,21-,22+,24+/m1/s1 |
| InChIKey | SBLIWECABYEGKC-JCELYEKWSA-N |
| XLogP | 6.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|