C21H19NO4 — CID 134941762
(E,4Z)-4-(1-benzyl-4,6-dimethoxy-2-oxoindol-3-ylidene)but-2-enal (PubChem CID 134941762) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is (E,4Z)-4-(1-benzyl-4,6-dimethoxy-2-oxoindol-3-ylidene)but-2-enal.
| Compound Name | (E,4Z)-4-(1-benzyl-4,6-dimethoxy-2-oxoindol-3-ylidene)but-2-enal |
|---|---|
| PubChem CID | 134941762 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (E,4Z)-4-(1-benzyl-4,6-dimethoxy-2-oxoindol-3-ylidene)but-2-enal |
| SMILES | COc1cc(OC)c2c(c1)N(Cc1ccccc1)C(=O)/C2=C\C=C\C=O |
| InChI | InChI=1S/C21H19NO4/c1-25-16-12-18-20(19(13-16)26-2)17(10-6-7-11-23)21(24)22(18)14-15-8-4-3-5-9-15/h3-13H,14H2,1-2H3/b7-6+,17-10- |
| InChIKey | XPCLKCSPGBNFLZ-SVHBSCFYSA-N |
| XLogP | 3.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|