C34H64O3Si2 — CID 134942378
tert-butyl-[(4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-6,10-dimethylundec-9-en-1-yn-4-yl]oxy-dimethylsilane (PubChem CID 134942378) has the molecular formula C34H64O3Si2 and a molecular weight of 577.06 g/mol. Its IUPAC name is tert-butyl-[(4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-6,10-dimethylundec-9-en-1-yn-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-6,10-dimethylundec-9-en-1-yn-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134942378 |
| Molecular Formula | C34H64O3Si2 |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | tert-butyl-[(4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-6,10-dimethylundec-9-en-1-yn-4-yl]oxy-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C1CO[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C=C)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C34H64O3Si2/c1-17-20-31(36-38(15,16)34(12,13)14)32(28(11)22-19-21-24(3)4)30-23-35-33(29(30)18-2)37-39(25(5)6,26(7)8)27(9)10/h1,18,21,25-33H,2,19-20,22-23H2,3-16H3/t28-,29+,30?,31-,32+,33+/m1/s1 |
| InChIKey | ROBLYSIKXIECGH-IALKZTHMSA-N |
| XLogP | 10.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|