C26H48O3Si — CID 134942380
(3aS,6E,9R,10S)-9-[tert-butyl(dimethyl)silyl]oxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,3a,4,5,8,9,10,10a-octahydro-1H-cyclonona[c]furan-3-ol (PubChem CID 134942380) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is (3aS,6E,9R,10S)-9-[tert-butyl(dimethyl)silyl]oxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,3a,4,5,8,9,10,10a-octahydro-1H-cyclonona[c]furan-3-ol.
| Compound Name | (3aS,6E,9R,10S)-9-[tert-butyl(dimethyl)silyl]oxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,3a,4,5,8,9,10,10a-octahydro-1H-cyclonona[c]furan-3-ol |
|---|---|
| PubChem CID | 134942380 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | (3aS,6E,9R,10S)-9-[tert-butyl(dimethyl)silyl]oxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,3a,4,5,8,9,10,10a-octahydro-1H-cyclonona[c]furan-3-ol |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1C2COC(O)[C@H]2CC/C=C(\C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O3Si/c1-18(2)12-10-14-20(4)24-22-17-28-25(27)21(22)15-11-13-19(3)16-23(24)29-30(8,9)26(5,6)7/h12-13,20-25,27H,10-11,14-17H2,1-9H3/b19-13+/t20-,21+,22?,23-,24+,25?/m1/s1 |
| InChIKey | SUIWBSLLWBUFMH-SMHLUUTFSA-N |
| XLogP | 7.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|