C10H11LiO — CID 134943604
lithium (3S)-3,6-dimethyl-3,5-dihydro-2H-1-benzofuran-5-ide (PubChem CID 134943604) has the molecular formula C10H11LiO and a molecular weight of 154.14 g/mol. Its IUPAC name is lithium (3S)-3,6-dimethyl-3,5-dihydro-2H-1-benzofuran-5-ide.
| Compound Name | lithium (3S)-3,6-dimethyl-3,5-dihydro-2H-1-benzofuran-5-ide |
|---|---|
| PubChem CID | 134943604 |
| Molecular Formula | C10H11LiO |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | lithium (3S)-3,6-dimethyl-3,5-dihydro-2H-1-benzofuran-5-ide |
| SMILES | Cc1[c-]cc2c(c1)OC[C@H]2C.[Li+] |
| InChI | InChI=1S/C10H11O.Li/c1-7-3-4-9-8(2)6-11-10(9)5-7;/h4-5,8H,6H2,1-2H3;/q-1;+1/t8-;/m1./s1 |
| InChIKey | IJAYTFFNDFGFFI-DDWIOCJRSA-N |
| XLogP | -0.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|