C17H28N4O4 — CID 134943865
propan-2-yl (2S,3R,4S)-3-acetamido-4-azido-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 134943865) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is propan-2-yl (2S,3R,4S)-3-acetamido-4-azido-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | propan-2-yl (2S,3R,4S)-3-acetamido-4-azido-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 134943865 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | propan-2-yl (2S,3R,4S)-3-acetamido-4-azido-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCC(CC)C[C@@H]1OC(C(=O)OC(C)C)=C[C@H](N=[N+]=[N-])[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H28N4O4/c1-6-12(7-2)8-14-16(19-11(5)22)13(20-21-18)9-15(25-14)17(23)24-10(3)4/h9-10,12-14,16H,6-8H2,1-5H3,(H,19,22)/t13-,14-,16+/m0/s1 |
| InChIKey | YQOGSQRAOCYXCW-OFQRWUPVSA-N |
| XLogP | 3.23 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|