C18H26O2 — CID 134944098
(1R,3aS,9bR)-6-hydroxy-3a,8-dimethyl-1-propan-2-yl-2,3,4,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-5-one (PubChem CID 134944098) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1R,3aS,9bR)-6-hydroxy-3a,8-dimethyl-1-propan-2-yl-2,3,4,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-5-one.
| Compound Name | (1R,3aS,9bR)-6-hydroxy-3a,8-dimethyl-1-propan-2-yl-2,3,4,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-5-one |
|---|---|
| PubChem CID | 134944098 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1R,3aS,9bR)-6-hydroxy-3a,8-dimethyl-1-propan-2-yl-2,3,4,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-5-one |
| SMILES | CC1=CC(O)=C2C(=O)C[C@]3(C)CC[C@H](C(C)C)[C@@H]3C2C1 |
| InChI | InChI=1S/C18H26O2/c1-10(2)12-5-6-18(4)9-15(20)16-13(17(12)18)7-11(3)8-14(16)19/h8,10,12-13,17,19H,5-7,9H2,1-4H3/t12-,13?,17-,18+/m1/s1 |
| InChIKey | LDUCKQLDWUCDSI-YAIFJKPRSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |