C17H24O3 — CID 134944251
[(2R)-2,6,6,8-tetramethyl-11-oxo-10-tricyclo[5.3.1.01,5]undec-8-enyl] acetate (PubChem CID 134944251) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(2R)-2,6,6,8-tetramethyl-11-oxo-10-tricyclo[5.3.1.01,5]undec-8-enyl] acetate.
| Compound Name | [(2R)-2,6,6,8-tetramethyl-11-oxo-10-tricyclo[5.3.1.01,5]undec-8-enyl] acetate |
|---|---|
| PubChem CID | 134944251 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(2R)-2,6,6,8-tetramethyl-11-oxo-10-tricyclo[5.3.1.01,5]undec-8-enyl] acetate |
| SMILES | CC(=O)OC1C=C(C)C2C(=O)C13C(C)CCC3C2(C)C |
| InChI | InChI=1S/C17H24O3/c1-9-8-13(20-11(3)18)17-10(2)6-7-12(17)16(4,5)14(9)15(17)19/h8,10,12-14H,6-7H2,1-5H3 |
| InChIKey | DAFYYNHHMUQQHV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|