C11H20O2 — CID 134944397
2-[(1R,3S)-3-(hydroxymethyl)-3-methyl-2-methylidenecyclopentyl]propan-2-ol (PubChem CID 134944397) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[(1R,3S)-3-(hydroxymethyl)-3-methyl-2-methylidenecyclopentyl]propan-2-ol.
| Compound Name | 2-[(1R,3S)-3-(hydroxymethyl)-3-methyl-2-methylidenecyclopentyl]propan-2-ol |
|---|---|
| PubChem CID | 134944397 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-[(1R,3S)-3-(hydroxymethyl)-3-methyl-2-methylidenecyclopentyl]propan-2-ol |
| SMILES | C=C1[C@H](C(C)(C)O)CC[C@]1(C)CO |
| InChI | InChI=1S/C11H20O2/c1-8-9(10(2,3)13)5-6-11(8,4)7-12/h9,12-13H,1,5-7H2,2-4H3/t9-,11-/m1/s1 |
| InChIKey | IWZXWQAQBFSABU-MWLCHTKSSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|