C14H26O2 — CID 134861047
cis-(1R,2R)-2-[(2S)-4-hydroxybutan-2-yl]-4,4-dimethyl-2-prop-2-enylcyclopentan-1-ol (PubChem CID 134861047) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is cis-(1R,2R)-2-[(2S)-4-hydroxybutan-2-yl]-4,4-dimethyl-2-prop-2-enylcyclopentan-1-ol.
| Compound Name | cis-(1R,2R)-2-[(2S)-4-hydroxybutan-2-yl]-4,4-dimethyl-2-prop-2-enylcyclopentan-1-ol |
|---|---|
| PubChem CID | 134861047 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | cis-(1R,2R)-2-[(2S)-4-hydroxybutan-2-yl]-4,4-dimethyl-2-prop-2-enylcyclopentan-1-ol |
| SMILES | C=CC[C@]1([C@@H](C)CCO)CC(C)(C)C[C@H]1O |
| InChI | InChI=1S/C14H26O2/c1-5-7-14(11(2)6-8-15)10-13(3,4)9-12(14)16/h5,11-12,15-16H,1,6-10H2,2-4H3/t11-,12+,14+/m0/s1 |
| InChIKey | IBCIOPDHJXQGFW-OUCADQQQSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|