C11H20O2 — CID 15348633
cis-(1S,3R)-3-(2-methoxyethyl)-2,2-dimethyl-5-methylidenecyclopentan-1-ol (PubChem CID 15348633) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is cis-(1S,3R)-3-(2-methoxyethyl)-2,2-dimethyl-5-methylidenecyclopentan-1-ol.
| Compound Name | cis-(1S,3R)-3-(2-methoxyethyl)-2,2-dimethyl-5-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 15348633 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | cis-(1S,3R)-3-(2-methoxyethyl)-2,2-dimethyl-5-methylidenecyclopentan-1-ol |
| SMILES | C=C1C[C@H](CCOC)C(C)(C)[C@H]1O |
| InChI | InChI=1S/C11H20O2/c1-8-7-9(5-6-13-4)11(2,3)10(8)12/h9-10,12H,1,5-7H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | VGYMPFKBFPBVQD-UWVGGRQHSA-N |
| XLogP | 1.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|