C25H41NO5Si — CID 134944815
(4S,5S)-5-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-(phenylmethoxymethoxy)pentyl]-4-ethenyl-1,3-oxazolidin-2-one (PubChem CID 134944815) has the molecular formula C25H41NO5Si and a molecular weight of 463.69 g/mol. Its IUPAC name is (4S,5S)-5-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-(phenylmethoxymethoxy)pentyl]-4-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-(phenylmethoxymethoxy)pentyl]-4-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134944815 |
| Molecular Formula | C25H41NO5Si |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (4S,5S)-5-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-(phenylmethoxymethoxy)pentyl]-4-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1NC(=O)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCOCc1ccccc1)C(C)C |
| InChI | InChI=1S/C25H41NO5Si/c1-9-20-21(30-24(27)26-20)15-22(31-32(7,8)25(4,5)6)23(18(2)3)29-17-28-16-19-13-11-10-12-14-19/h9-14,18,20-23H,1,15-17H2,2-8H3,(H,26,27)/t20-,21-,22-,23-/m0/s1 |
| InChIKey | GHTHVENIWMXEHA-MLCQCVOFSA-N |
| XLogP | 5.65 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|