C24H38O5Si — CID 134945352
(4S,7S,9R,10R,11S,12R)-9-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one (PubChem CID 134945352) has the molecular formula C24H38O5Si and a molecular weight of 434.65 g/mol. Its IUPAC name is (4S,7S,9R,10R,11S,12R)-9-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one.
| Compound Name | (4S,7S,9R,10R,11S,12R)-9-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
|---|---|
| PubChem CID | 134945352 |
| Molecular Formula | C24H38O5Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (4S,7S,9R,10R,11S,12R)-9-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
| SMILES | CC(=O)[C@@H]1O[C@H]2C(C)=C[C@@]3(CO[Si](C)(C)C(C)(C)C)COC4(C)C(=O)[C@]1(C)[C@]2(C)[C@H]43 |
| InChI | InChI=1S/C24H38O5Si/c1-14-11-24(13-28-30(9,10)20(3,4)5)12-27-23(8)18(24)21(6)16(14)29-17(15(2)25)22(21,7)19(23)26/h11,16-18H,12-13H2,1-10H3/t16-,17-,18+,21-,22+,23?,24-/m0/s1 |
| InChIKey | GYIHXNYCKPXLKH-VZVDKZFLSA-N |
| XLogP | 4.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|