C24H38O4Si — CID 135028289
(4S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-ethenyl-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one (PubChem CID 135028289) has the molecular formula C24H38O4Si and a molecular weight of 418.65 g/mol. Its IUPAC name is (4S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-ethenyl-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one.
| Compound Name | (4S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-ethenyl-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
|---|---|
| PubChem CID | 135028289 |
| Molecular Formula | C24H38O4Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (4S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-ethenyl-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
| SMILES | C=CC1OC2C(C)=C[C@@]3(CO[Si](C)(C)C(C)(C)C)COC4(C)C(=O)[C@]1(C)[C@]2(C)[C@H]43 |
| InChI | InChI=1S/C24H38O4Si/c1-11-16-21(6)19(25)23(8)18-22(21,7)17(28-16)15(2)12-24(18,13-26-23)14-27-29(9,10)20(3,4)5/h11-12,16-18H,1,13-14H2,2-10H3/t16?,17?,18-,21-,22+,23?,24+/m1/s1 |
| InChIKey | QUTGTGFEUHOQOF-WWHJOMJKSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|