C23H38O4Si — CID 134945351
(4S,7S,9S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,9,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one (PubChem CID 134945351) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (4S,7S,9S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,9,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one.
| Compound Name | (4S,7S,9S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,9,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
|---|---|
| PubChem CID | 134945351 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (4S,7S,9S,10R,11S,12R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,9,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
| SMILES | CC1=C[C@@]2(CO[Si](C)(C)C(C)(C)C)COC3(C)C(=O)[C@@]4(C)[C@H](C)O[C@@H]1[C@@]4(C)[C@H]32 |
| InChI | InChI=1S/C23H38O4Si/c1-14-11-23(13-26-28(9,10)19(3,4)5)12-25-22(8)17(23)21(7)16(14)27-15(2)20(21,6)18(22)24/h11,15-17H,12-13H2,1-10H3/t15-,16-,17+,20+,21-,22?,23-/m0/s1 |
| InChIKey | NTXMJQMHACRJEL-WSOGDWPKSA-N |
| XLogP | 4.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|