C15H22O2 — CID 134945418
(8R,9aR)-5a-methyl-8-prop-1-en-2-yl-1,3a,4,5,6,7,8,9-octahydroindeno[1,7a-b]furan-2-one (PubChem CID 134945418) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (8R,9aR)-5a-methyl-8-prop-1-en-2-yl-1,3a,4,5,6,7,8,9-octahydroindeno[1,7a-b]furan-2-one.
| Compound Name | (8R,9aR)-5a-methyl-8-prop-1-en-2-yl-1,3a,4,5,6,7,8,9-octahydroindeno[1,7a-b]furan-2-one |
|---|---|
| PubChem CID | 134945418 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (8R,9aR)-5a-methyl-8-prop-1-en-2-yl-1,3a,4,5,6,7,8,9-octahydroindeno[1,7a-b]furan-2-one |
| SMILES | C=C(C)[C@@H]1CCC2(C)CCC3OC(=O)C[C@@]32C1 |
| InChI | InChI=1S/C15H22O2/c1-10(2)11-4-6-14(3)7-5-12-15(14,8-11)9-13(16)17-12/h11-12H,1,4-9H2,2-3H3/t11-,12?,14?,15+/m1/s1 |
| InChIKey | MDLSXBKDWNZDOC-DGLGBPBLSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|