C27H18N6 — CID 134945447
28,29,30,31,32,33-hexazaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene (PubChem CID 134945447) has the molecular formula C27H18N6 and a molecular weight of 426.48 g/mol. Its IUPAC name is 28,29,30,31,32,33-hexazaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene.
| Compound Name | 28,29,30,31,32,33-hexazaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene |
|---|---|
| PubChem CID | 134945447 |
| Molecular Formula | C27H18N6 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 28,29,30,31,32,33-hexazaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene |
| SMILES | C1=C/C2=C3\C=CC(=N3)C3=CC=C/C(=C4\C=CC(=N4)C4=CC=C/C(=C5\C=CC(=N5)C(=C1)N2)N4)N3 |
| InChI | InChI=1S/C27H18N6/c1-4-16-22-10-12-24(31-22)18-6-2-8-20(29-18)26-14-15-27(33-26)21-9-3-7-19(30-21)25-13-11-23(32-25)17(5-1)28-16/h1-15,28-30H/b22-16-,23-17-,24-18-,25-19+,26-20+,27-21- |
| InChIKey | SOYWUBHEHCSDJJ-IYSPIGIQSA-N |
| XLogP | 3.80 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|