C22H21FO6 — CID 134946040
trans-2-O,3-O-dibenzyl 1-O-ethyl (2S,3S)-1-fluorocyclopropane-1,2,3-tricarboxylate (PubChem CID 134946040) has the molecular formula C22H21FO6 and a molecular weight of 400.40 g/mol. Its IUPAC name is trans-2-O,3-O-dibenzyl 1-O-ethyl (2S,3S)-1-fluorocyclopropane-1,2,3-tricarboxylate.
| Compound Name | trans-2-O,3-O-dibenzyl 1-O-ethyl (2S,3S)-1-fluorocyclopropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 134946040 |
| Molecular Formula | C22H21FO6 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | trans-2-O,3-O-dibenzyl 1-O-ethyl (2S,3S)-1-fluorocyclopropane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C1(F)[C@H](C(=O)OCc2ccccc2)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H21FO6/c1-2-27-21(26)22(23)17(19(24)28-13-15-9-5-3-6-10-15)18(22)20(25)29-14-16-11-7-4-8-12-16/h3-12,17-18H,2,13-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | XLVYWXOHPZBZIL-ROUUACIJSA-N |
| XLogP | 2.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|