C22H36O4Si — CID 134946754
tert-butyl 2-[(2S)-7-[(Z)-but-2-enyl]-5-[(2S)-but-3-en-2-yl]-3,3,4-trimethyl-2,5-dihydrooxasilolo[2,3-b]oxasilol-2-yl]acetate (PubChem CID 134946754) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-7-[(Z)-but-2-enyl]-5-[(2S)-but-3-en-2-yl]-3,3,4-trimethyl-2,5-dihydrooxasilolo[2,3-b]oxasilol-2-yl]acetate.
| Compound Name | tert-butyl 2-[(2S)-7-[(Z)-but-2-enyl]-5-[(2S)-but-3-en-2-yl]-3,3,4-trimethyl-2,5-dihydrooxasilolo[2,3-b]oxasilol-2-yl]acetate |
|---|---|
| PubChem CID | 134946754 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | tert-butyl 2-[(2S)-7-[(Z)-but-2-enyl]-5-[(2S)-but-3-en-2-yl]-3,3,4-trimethyl-2,5-dihydrooxasilolo[2,3-b]oxasilol-2-yl]acetate |
| SMILES | C=C[C@H](C)C1O[Si]2(C/C=C\C)O[C@@H](CC(=O)OC(C)(C)C)C(C)(C)C2=C1C |
| InChI | InChI=1S/C22H36O4Si/c1-10-12-13-27-20(16(4)19(26-27)15(3)11-2)22(8,9)17(25-27)14-18(23)24-21(5,6)7/h10-12,15,17,19H,2,13-14H2,1,3-9H3/b12-10-/t15-,17-,19?,27?/m0/s1 |
| InChIKey | CNPMVQNUMHZZOV-WGGRKQPHSA-N |
| XLogP | 5.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|