C25H27NO6S — CID 134947234
dimethyl (2R,5R)-5-ethenyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]pyrrolidine-3,3-dicarboxylate (PubChem CID 134947234) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is dimethyl (2R,5R)-5-ethenyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]pyrrolidine-3,3-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-5-ethenyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]pyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 134947234 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | dimethyl (2R,5R)-5-ethenyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]pyrrolidine-3,3-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](/C=C/c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H27NO6S/c1-5-20-17-25(23(27)31-3,24(28)32-4)22(16-13-19-9-7-6-8-10-19)26(20)33(29,30)21-14-11-18(2)12-15-21/h5-16,20,22H,1,17H2,2-4H3/b16-13+/t20-,22+/m0/s1 |
| InChIKey | VINUVMWSBAIMHD-ZTKAZNOESA-N |
| XLogP | 3.36 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|