C24H35NO5 — CID 134947359
tert-butyl (3S)-3-heptyl-3-(3-methoxy-3-oxopropyl)-2-oxoindole-1-carboxylate (PubChem CID 134947359) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl (3S)-3-heptyl-3-(3-methoxy-3-oxopropyl)-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-heptyl-3-(3-methoxy-3-oxopropyl)-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 134947359 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | tert-butyl (3S)-3-heptyl-3-(3-methoxy-3-oxopropyl)-2-oxoindole-1-carboxylate |
| SMILES | CCCCCCC[C@@]1(CCC(=O)OC)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C24H35NO5/c1-6-7-8-9-12-16-24(17-15-20(26)29-5)18-13-10-11-14-19(18)25(21(24)27)22(28)30-23(2,3)4/h10-11,13-14H,6-9,12,15-17H2,1-5H3/t24-/m0/s1 |
| InChIKey | FLGBBLUAZSYICM-DEOSSOPVSA-N |
| XLogP | 5.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|