C18H28O4 — CID 134947940
5-O-tert-butyl 4-O-ethyl (3aS,4R,5R,7aR)-7-methylidene-1,2,3,3a,4,5,6,7a-octahydroindene-4,5-dicarboxylate (PubChem CID 134947940) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 5-O-tert-butyl 4-O-ethyl (3aS,4R,5R,7aR)-7-methylidene-1,2,3,3a,4,5,6,7a-octahydroindene-4,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 4-O-ethyl (3aS,4R,5R,7aR)-7-methylidene-1,2,3,3a,4,5,6,7a-octahydroindene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 134947940 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 5-O-tert-butyl 4-O-ethyl (3aS,4R,5R,7aR)-7-methylidene-1,2,3,3a,4,5,6,7a-octahydroindene-4,5-dicarboxylate |
| SMILES | C=C1C[C@@H](C(=O)OC(C)(C)C)[C@H](C(=O)OCC)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C18H28O4/c1-6-21-17(20)15-13-9-7-8-12(13)11(2)10-14(15)16(19)22-18(3,4)5/h12-15H,2,6-10H2,1,3-5H3/t12-,13-,14+,15+/m0/s1 |
| InChIKey | MHLXJSZUOGTNLC-BYNSBNAKSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|