C23H34O8 — CID 134947948
5-O-tert-butyl 2-O,2-O'-diethyl 4-O-methyl (3aS,4R,5R,7aR)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate (PubChem CID 134947948) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O,2-O'-diethyl 4-O-methyl (3aS,4R,5R,7aR)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate.
| Compound Name | 5-O-tert-butyl 2-O,2-O'-diethyl 4-O-methyl (3aS,4R,5R,7aR)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 134947948 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-O-tert-butyl 2-O,2-O'-diethyl 4-O-methyl (3aS,4R,5R,7aR)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate |
| SMILES | C=C1C[C@@H](C(=O)OC(C)(C)C)[C@H](C(=O)OC)[C@H]2CC(C(=O)OCC)(C(=O)OCC)C[C@@H]12 |
| InChI | InChI=1S/C23H34O8/c1-8-29-20(26)23(21(27)30-9-2)11-15-13(3)10-14(18(24)31-22(4,5)6)17(16(15)12-23)19(25)28-7/h14-17H,3,8-12H2,1-2,4-7H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | VKAYQICTWPLWPX-QZWWFDLISA-N |
| XLogP | 2.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|