C21H28O7 — CID 135035196
diethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-acetyloxypropanedioate (PubChem CID 135035196) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is diethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-acetyloxypropanedioate.
| Compound Name | diethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-acetyloxypropanedioate |
|---|---|
| PubChem CID | 135035196 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | diethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-acetyloxypropanedioate |
| SMILES | C=C1[C@H]2C[C@H]2[C@]2(C)CC(=O)C(C(OC(C)=O)(C(=O)OCC)C(=O)OCC)C[C@@H]12 |
| InChI | InChI=1S/C21H28O7/c1-6-26-18(24)21(28-12(4)22,19(25)27-7-2)16-9-14-11(3)13-8-15(13)20(14,5)10-17(16)23/h13-16H,3,6-10H2,1-2,4-5H3/t13-,14+,15-,16?,20-/m1/s1 |
| InChIKey | HMGWBOUYEGBHIA-CFRXEXMFSA-N |
| XLogP | 2.22 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|