C24H33F3O8 — CID 102113482
5-O-tert-butyl 2-O,2-O'-diethyl 4-O-(2,2,2-trifluoroethyl) 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate (PubChem CID 102113482) has the molecular formula C24H33F3O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O,2-O'-diethyl 4-O-(2,2,2-trifluoroethyl) 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate.
| Compound Name | 5-O-tert-butyl 2-O,2-O'-diethyl 4-O-(2,2,2-trifluoroethyl) 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 102113482 |
| Molecular Formula | C24H33F3O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 5-O-tert-butyl 2-O,2-O'-diethyl 4-O-(2,2,2-trifluoroethyl) 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate |
| SMILES | C=C1CC(C(=O)OC(C)(C)C)C(C(=O)OCC(F)(F)F)C2CC(C(=O)OCC)(C(=O)OCC)CC12 |
| InChI | InChI=1S/C24H33F3O8/c1-7-32-20(30)23(21(31)33-8-2)10-15-13(3)9-14(18(28)35-22(4,5)6)17(16(15)11-23)19(29)34-12-24(25,26)27/h14-17H,3,7-12H2,1-2,4-6H3 |
| InChIKey | FQSYRHAPWMWPSO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|